CymitQuimica logo

CAS 927801-19-2

:

3,6-Dibromo-4-chloroquinoline

Description:
3,6-Dibromo-4-chloroquinoline is a synthetic organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features two bromine atoms at the 3 and 6 positions and a chlorine atom at the 4 position of the quinoline ring, contributing to its unique reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of halogen substituents can enhance its lipophilicity and influence its interactions with biological targets, making it of interest in medicinal chemistry and material science. Additionally, the compound may exhibit properties such as fluorescence or photostability, which can be advantageous in various applications, including pharmaceuticals and agrochemicals. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can pose environmental and health risks.
Formula:C9H4Br2ClN
InChI:InChI=1S/C9H4Br2ClN/c10-5-1-2-8-6(3-5)9(12)7(11)4-13-8/h1-4H
InChI key:InChIKey=PHAZSUJOBODVGL-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=CC1Br)C=CC(Br)=C2
Synonyms:
  • Quinoline, 3,6-Dibromo-4-Chloro-
  • 3,6-Dibromo-4-chloroquinoline
Found 3 products.