CymitQuimica logo

CAS 92786-68-0

:

H-Asp(OtBu)-NH2 . HCl

Description:
H-Asp(OtBu)-NH2·HCl, also known as t-butyl L-aspartate hydrochloride, is a derivative of the amino acid aspartic acid. This compound features a t-butoxy (OtBu) protecting group on the carboxyl side chain of aspartic acid, which enhances its stability and solubility in organic solvents. The presence of the hydrochloride (HCl) indicates that it is in a salt form, which typically improves its solubility in water and facilitates handling in various applications. H-Asp(OtBu)-NH2·HCl is often utilized in peptide synthesis and as a building block in the development of pharmaceuticals and biochemicals. Its structure includes an amine group (NH2) that can participate in further reactions, making it versatile in synthetic chemistry. The compound is generally characterized by its white crystalline appearance and is stable under standard laboratory conditions. As with many amino acid derivatives, it may exhibit biological activity, and its properties can be influenced by the presence of the t-butoxy group and the hydrochloride salt form.
Formula:C8H16N2O3·HCl
InChI:InChI=1S/C8H16N2O3.ClH/c1-8(2,3)13-6(11)4-5(9)7(10)12;/h5H,4,9H2,1-3H3,(H2,10,12);1H/t5-;/m0./s1
InChI key:MGCQDVMGXZJHTN-JEDNCBNOSA-N
SMILES:CC(C)(C)OC(=O)C[C@@H](C(=O)N)N.Cl
Synonyms:
  • H-Asp(Otbu)-Nh2 Hcl
Found 3 products.