![5-Pyrimidinecarboxamide,N-[4-[4-(4-morpholinylcarbonyl)-1-piperidinyl]phenyl]-2-phenoxy-](https://static.cymitquimica.com/cas-image/thumb-webp/399540-5-pyrimidinecarboxamide-n-4-4-4-morpholinylcarbonyl-1-piperidinyl-phenyl-2-phenoxy.webp)
CAS 927878-49-7
:5-Pyrimidinecarboxamide,N-[4-[4-(4-morpholinylcarbonyl)-1-piperidinyl]phenyl]-2-phenoxy-
Description:
5-Pyrimidinecarboxamide, N-[4-[4-(4-morpholinylcarbonyl)-1-piperidinyl]phenyl]-2-phenoxy- is a synthetic organic compound characterized by its complex structure, which includes a pyrimidine ring, a carboxamide functional group, and multiple aromatic and heterocyclic moieties. This compound is typically classified as a pharmaceutical intermediate or a potential drug candidate due to its intricate arrangement of functional groups that may interact with biological targets. The presence of the morpholine and piperidine rings suggests potential for modulation of biological activity, possibly influencing receptor interactions or enzyme inhibition. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, as well as the presence of substituents that can affect its pharmacokinetic properties. As with many compounds of this nature, safety and toxicity profiles would need to be evaluated through rigorous testing to determine its suitability for therapeutic applications. Overall, this compound exemplifies the complexity often found in drug design and development.
Formula:C27H29N5O4
InChI:InChI=1S/C27H29N5O4/c33-25(21-18-28-27(29-19-21)36-24-4-2-1-3-5-24)30-22-6-8-23(9-7-22)31-12-10-20(11-13-31)26(34)32-14-16-35-17-15-32/h1-9,18-20H,10-17H2,(H,30,33)
InChI key:NLSSUSRERAMBTA-UHFFFAOYSA-N
SMILES:C1CN(CCC1C(=O)N2CCOCC2)C3=CC=C(C=C3)NC(=O)C4=CN=C(N=C4)OC5=CC=CC=C5
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
N-(4-(4-(Morpholine-4-carbonyl)piperidin-1-yl)phenyl)-2-phenoxypyrimidine-5-carboxamide
CAS:N-(4-(4-(Morpholine-4-carbonyl)piperidin-1-yl)phenyl)-2-phenoxypyrimidine-5-carboxamideFormula:C27H29N5O4Purity:98%Molecular weight:487.56N-(4-(4-(Morpholine-4-carbonyl)piperidin-1-yl)phenyl)-2-phenoxypyrimidine-5-carboxamide
CAS:Formula:C27H29N5O4Purity:98%Molecular weight:487.5503N-(4-(4-(Morpholine-4-carbonyl)piperidin-1-yl)phenyl)-2-phenoxypyrimidine-5-carboxamide
CAS:N-(4-(4-(Morpholine-4-carbonyl)piperidin-1-yl)phenyl)-2-phenoxypyrimidine-5-carboxamideFormula:C27H29N5O4Purity:98%Molecular weight:487.55TFC 007
CAS:TFC 007 is a small molecule that has been shown to cause cardiac hypertrophy in animals. It binds to the receptor for ubiquitin and the ligand, which are involved in the inflammatory process. TFC 007 is a ligand-binding molecule that activates the ubiquitin-proteasome system, leading to cell death. TFC 007 also inhibits the synthesis of inflammatory cytokines, such as IL-1β and IL-6, by binding to their respective receptors. This inhibition leads to decreased levels of proinflammatory cytokines and reduced cardiac hypertrophy.Formula:C27H29N5O4Purity:Min. 95%Molecular weight:487.5 g/molTFC-007
CAS:TFC-007 is an H-PGDS inhibitor, reducing inflammation, useful for studying guinea pig allergic rhinitis induced by cedar pollen.Formula:C27H29N5O4Purity:98.07%Color and Shape:SolidMolecular weight:487.55
