CymitQuimica logo

CAS 92796-40-2

:

6-bromo-4-methyl-3-phenyl-2H-chromen-2-one

Description:
6-Bromo-4-methyl-3-phenyl-2H-chromen-2-one, identified by its CAS number 92796-40-2, is a synthetic organic compound belonging to the class of flavonoids, specifically a chromone derivative. This compound features a chromenone backbone, characterized by a fused benzene and pyrone ring structure, which contributes to its potential biological activity. The presence of a bromine atom at the 6-position and a methyl group at the 4-position, along with a phenyl group at the 3-position, introduces unique steric and electronic properties that can influence its reactivity and interactions with biological targets. Typically, compounds of this nature exhibit a range of pharmacological activities, including antioxidant, anti-inflammatory, and anticancer properties, making them of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can vary based on the functional groups present, which may affect its application in various fields such as pharmaceuticals and materials science.
Formula:C16H11BrO2
InChI:InChI=1/C16H11BrO2/c1-10-13-9-12(17)7-8-14(13)19-16(18)15(10)11-5-3-2-4-6-11/h2-9H,1H3
SMILES:Cc1c2cc(ccc2oc(=O)c1c1ccccc1)Br
Found 1 products.