CAS 928014-62-4
:1H-Indazole-5-propanoic acid, α-[[[4-(1,2-dihydro-2-oxo-3-quinolinyl)-1-piperidinyl]carbonyl]amino]-7-methyl-, (αR)-
Description:
1H-Indazole-5-propanoic acid, α-[[[4-(1,2-dihydro-2-oxo-3-quinolinyl)-1-piperidinyl]carbonyl]amino]-7-methyl-, (αR)-, with CAS number 928014-62-4, is a chemical compound characterized by its complex structure, which includes an indazole core, a propanoic acid moiety, and a piperidine ring substituted with a quinoline derivative. This compound exhibits properties typical of both indazole and quinoline derivatives, such as potential biological activity, which may include interactions with various receptors or enzymes. Its stereochemistry, indicated by the (αR) designation, suggests specific spatial arrangements that can influence its pharmacological properties. The presence of functional groups such as the carbonyl and amino groups contributes to its reactivity and solubility in various solvents. Overall, this compound may be of interest in medicinal chemistry for its potential therapeutic applications, although specific biological activities and mechanisms would require further investigation through experimental studies.
Formula:C26H27N5O4
InChI:InChI=1S/C26H27N5O4/c1-15-10-16(11-19-14-27-30-23(15)19)12-22(25(33)34)29-26(35)31-8-6-17(7-9-31)20-13-18-4-2-3-5-21(18)28-24(20)32/h2-5,10-11,13-14,17,22H,6-9,12H2,1H3,(H,27,30)(H,28,32)(H,29,35)(H,33,34)/t22-/m1/s1
InChI key:QROJAPWIUDLXLJ-JOCHJYFZSA-N
SMILES:CC1=CC(=CC2=C1NN=C2)C[C@H](C(=O)O)NC(=O)N3CCC(CC3)C4=CC5=CC=CC=C5NC4=O
Synonyms:- Hyoscine Butylbromide Impurity 7 Bromine(Hyoscine Butylbromide EP Impurity G Bromine)
- 1H-Indazole-5-propanoic acid, α-[[[4-(1,2-dihydro-2-oxo-3-quinolinyl)-1-piperidinyl]carbonyl]amino]-7-methyl-, (αR)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
