CymitQuimica logo

CAS 928025-63-2

:

(R)-1-Boc-3-isopropylpiperazine

Description:
(R)-1-Boc-3-isopropylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The "Boc" (tert-butoxycarbonyl) group is a protective group commonly used in organic synthesis to temporarily mask amines, enhancing the compound's stability and reactivity during various chemical reactions. The isopropyl substituent at the 3-position contributes to the compound's steric bulk and can influence its biological activity and interaction with receptors. This compound is often utilized in pharmaceutical research and development, particularly in the synthesis of potential drug candidates due to its structural features that may confer specific pharmacological properties. Its chirality, indicated by the "(R)" designation, suggests that it exists as one of two enantiomers, which can exhibit different biological activities. Overall, (R)-1-Boc-3-isopropylpiperazine is a valuable intermediate in medicinal chemistry, with applications in the design of therapeutics targeting various biological pathways.
Formula:C12H24N2O2
InChI:InChI=1S/C12H24N2O2/c1-9(2)10-8-14(7-6-13-10)11(15)16-12(3,4)5/h9-10,13H,6-8H2,1-5H3/t10-/m0/s1
InChI key:UHLAQCKNCBYTIF-JTQLQIEISA-N
SMILES:CC(C)[C@@H]1CN(CCN1)C(=O)OC(C)(C)C
Found 4 products.