CymitQuimica logo

CAS 928026-67-9

:

Quinoline, 2-(1-piperazinyl)-, hydrochloride (1:2)

Description:
Quinoline, 2-(1-piperazinyl)-, hydrochloride (1:2) is a chemical compound characterized by its quinoline backbone, which is a bicyclic aromatic compound known for its heterocyclic structure. The presence of a piperazine moiety enhances its pharmacological properties, making it of interest in medicinal chemistry, particularly for its potential biological activities. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial, antitumor, or psychoactive effects, depending on its specific interactions within biological systems. Its molecular structure allows for various functional group modifications, which can influence its reactivity and biological activity. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, Quinoline, 2-(1-piperazinyl)-, hydrochloride (1:2) represents a significant compound in the study of drug development and chemical synthesis.
Formula:C13H15N3·2ClH
InChI:InChI=1S/C13H15N3.2ClH/c1-2-4-12-11(3-1)5-6-13(15-12)16-9-7-14-8-10-16;;/h1-6,14H,7-10H2;2*1H
InChI key:InChIKey=NKSMLXMNONDXGH-UHFFFAOYSA-N
SMILES:C1(=NC2=C(C=C1)C=CC=C2)N3CCNCC3.Cl
Synonyms:
  • 2-(1-Piperazinyl)Quinoline dihydrochloride
  • 2-(Piperazin-1-yl)quinoline dihydrochloride
  • 2-(Piperazin-1-yl)quinoline hydrochloride (1:1)
  • Quinoline, 2-(1-piperazinyl)-, hydrochloride (1:1)
  • Quinoline, 2-(1-piperazinyl)-, hydrochloride (1:2)
Found 1 products.