CymitQuimica logo

CAS 928038-36-2

:

1,3'-Biazetidine dihydrochloride

Description:
1,3'-Biazetidine dihydrochloride, identified by its CAS number 928038-36-2, is a chemical compound characterized by its unique bicyclic structure, which includes two azetidine rings. This compound is typically encountered as a dihydrochloride salt, enhancing its solubility in water and making it suitable for various applications in medicinal chemistry and research. The presence of the dihydrochloride form indicates that it contains two hydrochloride groups, which can influence its stability and reactivity. As a bicyclic amine, 1,3'-Biazetidine dihydrochloride may exhibit interesting pharmacological properties, potentially acting as a ligand or a precursor in the synthesis of more complex molecules. Its structural features may contribute to its biological activity, making it a subject of interest in drug development. However, specific data regarding its toxicity, biological effects, and practical applications would require further investigation and should be approached with caution in laboratory settings.
Formula:C6H14N2Cl2
InChI:InChI=1S/C6H12N2.2ClH/c1-2-8(3-1)6-4-7-5-6;;/h6-7H,1-5H2;2*1H
InChI key:YPPQGGNUBRKDAR-UHFFFAOYSA-N
SMILES:C1CN(C1)C2CNC2.Cl.Cl
Synonyms:
  • 1-(3-Azetidinyl)-azetidine 2HCl
Found 3 products.