CymitQuimica logo

CAS 928053-38-7

:

Hydrazinecarboxylic acid, 1-cyclopropyl-, 1,1-dimethylethyl ester

Description:
Hydrazinecarboxylic acid, 1-cyclopropyl-, 1,1-dimethylethyl ester, identified by CAS number 928053-38-7, is an organic compound characterized by its unique structure that includes a hydrazine moiety and an ester functional group. This compound typically exhibits properties associated with both hydrazines and carboxylic acid derivatives, such as potential reactivity due to the presence of the hydrazine group, which can participate in various chemical reactions, including condensation and oxidation. The cyclopropyl group introduces ring strain, which can influence the compound's reactivity and stability. Additionally, the presence of the tert-butyl ester group may enhance lipophilicity, affecting its solubility in organic solvents. Hydrazine derivatives are often studied for their applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. However, due to the potential toxicity and reactivity of hydrazine compounds, handling requires caution. Overall, this compound's characteristics make it of interest in both synthetic chemistry and potential applications in various fields.
Formula:C8H16N2O2
InChI:InChI=1S/C8H16N2O2/c1-8(2,3)12-7(11)10(9)6-4-5-6/h6H,4-5,9H2,1-3H3
InChI key:CHUUBHKRQMMNAB-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N(C1CC1)N
Found 2 products.