CymitQuimica logo

CAS 928053-97-8

:

[5-fluoro-2-(trifluoromethyl)phenyl]boronic acid

Description:
[5-Fluoro-2-(trifluoromethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with both a fluorine atom and a trifluoromethyl group. This compound typically exhibits properties such as high reactivity due to the boronic acid moiety, which can participate in various chemical reactions, including Suzuki coupling and other cross-coupling reactions. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its electronic properties, making it useful in medicinal chemistry and material science. Additionally, the fluorine substituent can affect the compound's stability and solubility in different solvents. As a boronic acid, it can also form reversible complexes with diols, which is a key feature in applications such as drug delivery and sensor development. Overall, [5-fluoro-2-(trifluoromethyl)phenyl]boronic acid is a versatile compound with significant utility in synthetic organic chemistry.
Formula:C7H5BF4O2
InChI:InChI=1/C7H5BF4O2/c9-4-1-2-5(7(10,11)12)6(3-4)8(13)14/h1-3,13-14H
InChI key:LBDUHXAQWUKBEB-UHFFFAOYSA-N
SMILES:c1cc(c(cc1F)B(O)O)C(F)(F)F
Synonyms:
  • 5-Fluoro-2-(trifluoromethyl)benzeneboronic acid
  • 5-FLUORO-2-(trifluoromethyl)phenylboronic acid
  • B-[5-Fluoro-2-(trifluoromethyl)phenyl]boronic acid
  • boronic acid, B-[5-fluoro-2-(trifluoromethyl)phenyl]-
  • 5-Fluoro-2-trifluoromethylphenylboronic acid
Found 6 products.