CymitQuimica logo

CAS 92806-98-9

:

2-sulfanyl-1H-benzimidazol-6-ol

Description:
2-Sulfanyl-1H-benzimidazol-6-ol, also known by its CAS number 92806-98-9, is a chemical compound characterized by its benzimidazole core structure, which features a sulfur-containing thiol group (-SH) and a hydroxyl group (-OH) at specific positions on the aromatic ring. This compound typically exhibits properties associated with both heterocyclic compounds and thiols, including potential antioxidant activity due to the presence of the thiol group. It may also display biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the hydroxyl group can enhance its solubility in polar solvents, while the thiol group may contribute to its reactivity, particularly in redox reactions. Additionally, the compound's structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals, where its unique properties could be harnessed for therapeutic or protective effects. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.
Formula:C7H6N2OS
InChI:InChI=1/C7H6N2OS/c10-4-1-2-5-6(3-4)9-7(11)8-5/h1-3,10H,(H2,8,9,11)
InChI key:DFKVVBOVTVBURY-UHFFFAOYSA-N
SMILES:c1cc2c(cc1O)[nH]c(n2)S
Found 7 products.