CymitQuimica logo

CAS 92808-19-0

:

6-pyrrolidin-1-ylpyridin-3-amine

Description:
6-Pyrrolidin-1-ylpyridin-3-amine, with the CAS number 92808-19-0, is a chemical compound characterized by its pyridine and pyrrolidine functional groups. This substance features a pyridine ring substituted at the 3-position with an amino group and at the 6-position with a pyrrolidine moiety, which contributes to its potential biological activity. The presence of the amino group suggests that it may engage in hydrogen bonding and participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Its structural attributes may influence its solubility, stability, and interaction with biological targets. Additionally, compounds of this nature are often investigated for their pharmacological properties, including potential roles as neurotransmitter modulators or in other therapeutic applications. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility can vary based on purity and environmental conditions. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H13N3
InChI:InChI=1/C9H13N3/c10-8-3-4-9(11-7-8)12-5-1-2-6-12/h3-4,7H,1-2,5-6,10H2
InChI key:PURAXXHYQSQHAA-UHFFFAOYSA-N
SMILES:C1CCN(C1)c1ccc(cn1)N
Synonyms:
  • 3-Pyridinamine, 6-(1-Pyrrolidinyl)-
Found 4 products.