CymitQuimica logo

CAS 92808-20-3

:

1-[4-(5-Amino-2-pyridinyl)-1-piperazinyl]ethanone

Description:
1-[4-(5-Amino-2-pyridinyl)-1-piperazinyl]ethanone, with the CAS number 92808-20-3, is a chemical compound characterized by its complex structure that includes a piperazine ring and a pyridine moiety. This compound typically exhibits properties associated with both basic and aromatic functionalities, making it potentially useful in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the amino group on the pyridine ring suggests that it may participate in hydrogen bonding and other interactions, influencing its solubility and reactivity. Additionally, the ethanone functional group indicates that it may undergo typical carbonyl chemistry, such as nucleophilic addition. The compound's molecular structure allows for various potential applications, including acting as a ligand in coordination chemistry or serving as a scaffold for drug design. Overall, its unique combination of functional groups and structural features makes it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C11H16N4O
InChI:InChI=1S/C11H16N4O/c1-9(16)14-4-6-15(7-5-14)11-3-2-10(12)8-13-11/h2-3,8H,4-7,12H2,1H3
InChI key:InChIKey=CGLNAGNYUPXMKH-UHFFFAOYSA-N
SMILES:C(C)(=O)N1CCN(CC1)C2=CC=C(N)C=N2
Synonyms:
  • 6-(4-Acetyl-1-piperazinyl)-3-pyridinamine
  • 1-[4-(5-Aminopyridin-2-yl)piperazin-1-yl]ethan-1-one
  • Ethanone, 1-[4-(5-amino-2-pyridinyl)-1-piperazinyl]-
  • Piperazine, 1-acetyl-4-(5-amino-2-pyridinyl)-
  • 1-[4-(5-Amino-2-pyridinyl)-1-piperazinyl]ethanone
Found 1 products.