CymitQuimica logo

CAS 92808-22-5

:

Acetamide, N-(5-amino-2-pyridinyl)-N-methyl-

Description:
Acetamide, N-(5-amino-2-pyridinyl)-N-methyl- is an organic compound characterized by its amide functional group, which is derived from acetic acid. This substance features a pyridine ring substituted with an amino group at the 5-position and a methyl group attached to the nitrogen of the amide. The presence of the pyridine ring contributes to its aromatic properties, while the amino group can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by its functional groups and overall molecular geometry. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H11N3O
InChI:InChI=1S/C8H11N3O/c1-6(12)11(2)8-4-3-7(9)5-10-8/h3-5H,9H2,1-2H3
InChI key:LCKLLKQGQQZEOL-UHFFFAOYSA-N
SMILES:CC(=O)N(C)C1=NC=C(C=C1)N
Found 1 products.