CAS 928151-78-4

Formula: C35H56O12

InChI: InChI=1S/C35H56O12/c1-16(36)21-10-13-35-33(21,5)30(40)26(39)29-32(4)11-9-20(14-19(32)8-12-34(29,35)47-35)45-23-15-22(41-6)27(18(3)43-23)46-31-25(38)28(42-7)24(37)17(2)44-31/h17-31,37-40H,8-15H2,1-7H3/t17-,18-,19+,20+,21+,22-,23+,24-,25-,26+,27-,28-,29-,30-,31+,32+,33+,34+,35-/m1/s1

InChI key: WGOHWIVFCMYBJP-HCGZSUPLSA-N

SMILES: C[C@@H]1[C@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H](C[C@H]2OC)O[C@H]3CC[C@]4([C@H](C3)CC[C@]56[C@@H]4[C@@H]([C@H]([C@]7([C@]5(O6)CC[C@H]7C(=O)C)C)O)O)C)C)O)OC)O

Tenacissoside F

CAS: 928151-78-4

Tenacissoside F

Formula: C₃₅H₅₆O₁₂

Purity: ≥98%

Molecular weight: 668.81

Ref: 54-BUP20041

(S)-Tenacissoside F

CAS: 928151-78-4

(S)-Tenacissoside F(Tenacissoside F) is a newly identified steroidal glycoside。Its homologous compound Tenacissoside G can inhibit P-gp and block HepG2 cells in G1/S phase.

Formula: C₃₅H₅₆O₁₂

Purity: 99.86%

Color and Shape: Solid

Molecular weight: 668.8119

Ref: TM-TN5126

Tenacissoside F

CAS: 928151-78-4

Formula: C₃₅H₅₆O₁₂

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 668.821

Ref: BP-SBP00097

Tenacissoside F

CAS: 928151-78-4

Tenacissoside F is a triterpenoid saponin, which is a naturally occurring compound isolated from the plant genus *Marsdenia*. These plants have been traditionally used in herbal medicine, and the compound is extracted through advanced chromatographic techniques from the plant's tissues.

Formula: C₃₅H₅₆O₁₂

Purity: Min. 95%

Molecular weight: 668.8 g/mol

Ref: 3D-DMB15178