CymitQuimica logo

CAS 92818-36-5

:

5-(benzyloxy)-2,3-dihydro-1H-indole

Description:
5-(Benzyloxy)-2,3-dihydro-1H-indole is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a benzyloxy group at the 5-position enhances its reactivity and solubility in organic solvents. This compound typically exhibits properties such as moderate polarity due to the presence of the ether functional group, which can influence its interactions in various chemical environments. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to the electron-rich nature of the indole moiety. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which can be explored in pharmacological studies. Overall, 5-(benzyloxy)-2,3-dihydro-1H-indole is a versatile compound with applications in synthetic organic chemistry and potential therapeutic uses.
Formula:C15H15NO
InChI:InChI=1/C15H15NO/c1-2-4-12(5-3-1)11-17-14-6-7-15-13(10-14)8-9-16-15/h1-7,10,16H,8-9,11H2
InChI key:NHULNFPNWXCXDI-UHFFFAOYSA-N
SMILES:c1ccc(cc1)COc1ccc2c(CCN2)c1
Synonyms:
  • 1H-indole, 2,3-dihydro-5-(phenylmethoxy)-
  • 5-(Benzyloxy)indoline
Found 3 products.