CymitQuimica logo

CAS 92822-01-0

:

4-(4-methylbenzyl)piperidine

Description:
4-(4-Methylbenzyl)piperidine, identified by its CAS number 92822-01-0, is an organic compound characterized by a piperidine ring substituted with a 4-methylbenzyl group. This compound typically exhibits a molecular structure that includes a six-membered piperidine ring, which is a saturated nitrogen-containing heterocycle, and a phenyl group with a methyl substituent at the para position. The presence of the piperidine moiety contributes to its potential biological activity, as piperidine derivatives are often found in various pharmaceuticals and agrochemicals. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic aromatic component. Its chemical properties may include basicity due to the nitrogen atom in the piperidine ring, allowing it to participate in protonation reactions. Additionally, the compound's structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C13H19N
InChI:InChI=1/C13H19N/c1-11-2-4-12(5-3-11)10-13-6-8-14-9-7-13/h2-5,13-14H,6-10H2,1H3
InChI key:WOOPTEWYQWYUGW-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)CC1CCNCC1
Synonyms:
  • Piperidine, 4-[(4-Methylphenyl)Methyl]-
  • 4-(4-Methylbenzyl)piperidine
Found 3 products.