CymitQuimica logo

CAS 92822-03-2

:

Piperidine, 4-[(4-fluorophenyl)methyl]-, hydrochloride

Description:
Piperidine, 4-[(4-fluorophenyl)methyl]-, hydrochloride is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 4-fluorobenzyl group at the 4-position of the piperidine ring contributes to its unique properties. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and other polar solvents. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. Its molecular structure suggests that it may exhibit various pharmacological activities, including effects on the central nervous system. The fluorine atom in the aromatic ring can influence the compound's lipophilicity and metabolic stability, making it a subject of interest in drug design. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H16FN・ClH
InChI:InChI=1S/C12H16FN.ClH/c13-12-3-1-10(2-4-12)9-11-5-7-14-8-6-11;/h1-4,11,14H,5-9H2;1H
InChI key:OJKWWANXBGLGQN-UHFFFAOYSA-N
SMILES:C1CNCCC1CC2=CC=C(C=C2)F.Cl
Found 4 products.