CymitQuimica logo

CAS 92829-83-9

:

1,4-Dioxaspiro[4.5]decane, 8-(phenylmethoxy)-

Description:
1,4-Dioxaspiro[4.5]decane, 8-(phenylmethoxy)-, identified by its CAS number 92829-83-9, is a chemical compound characterized by its unique spirocyclic structure, which includes a dioxane moiety and a phenylmethoxy group. This compound features a bicyclic framework that contributes to its rigidity and potential for specific interactions in biological systems. The presence of the phenylmethoxy substituent enhances its lipophilicity, which may influence its solubility and reactivity. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The dioxaspiro structure can also impart unique stereochemical properties, affecting how the molecule interacts with biological targets. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the phenyl group and the overall molecular conformation. As with many organic compounds, its behavior in various solvents and under different conditions can provide insights into its potential applications in fields such as drug development or materials science.
Formula:C15H20O3
InChI:InChI=1S/C15H20O3/c1-2-4-13(5-3-1)12-16-14-6-8-15(9-7-14)17-10-11-18-15/h1-5,14H,6-12H2
InChI key:ODHJKDCIQWMCOS-UHFFFAOYSA-N
SMILES:C1CC2(CCC1OCC3=CC=CC=C3)OCCO2
Found 2 products.