CymitQuimica logo

CAS 928324-73-6

:

5-(2-Fluorophenyl)-1-(Pyridin-2-Ylsulfonyl)-1H-Pyrrole-3-Carbaldehyde

Description:
5-(2-Fluorophenyl)-1-(Pyridin-2-Ylsulfonyl)-1H-Pyrrole-3-Carbaldehyde is a chemical compound characterized by its complex structure, which includes a pyrrole ring, a fluorophenyl group, and a pyridine sulfonyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents, which may include dimethyl sulfoxide (DMSO) and ethanol, while being less soluble in water due to its hydrophobic regions. The presence of the aldehyde functional group suggests it may participate in various chemical reactions, including condensation and oxidation. Additionally, the fluorine atom in the 2-fluorophenyl group can influence the compound's electronic properties and reactivity, potentially enhancing its biological activity. The sulfonyl group can also contribute to the compound's stability and solubility characteristics. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential biological activities, although specific applications would depend on further research and testing.
Formula:C16H11FN2O3S
InChI:InChI=1S/C16H11FN2O3S/c17-14-6-2-1-5-13(14)15-9-12(11-20)10-19(15)23(21,22)16-7-3-4-8-18-16/h1-11H
InChI key:QEEFDCPCMMXZEQ-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)C2=CC(=CN2S(=O)(=O)C3=CC=CC=N3)C=O)F
Found 2 products.