CAS 92855-65-7

7-Benzyloxyindole-3-carboxaldehyde

Description:

7-Benzyloxyindole-3-carboxaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a benzyloxy group at the 7-position and an aldehyde functional group at the 3-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a white to off-white solid and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). Its molecular structure allows for various chemical modifications, making it a valuable intermediate in the synthesis of more complex molecules. The aldehyde group can participate in condensation reactions, while the indole moiety is known for its biological activity, including potential roles in neurotransmission and as a scaffold for drug development. As with many organic compounds, proper handling and storage are essential to maintain its stability and prevent degradation.

Formula: C₁₆H₁₃NO₂

InChI: InChI=1/C16H13NO2/c18-10-13-9-17-16-14(13)7-4-8-15(16)19-11-12-5-2-1-3-6-12/h1-10,17H,11H2

SMILES: c1ccc(cc1)COc1cccc2c(c[nH]c12)C=O

Synonyms:

• 1H-Indole-3-carboxaldehyde, 7-(phenylmethoxy)-
• 7-(Benzyloxy)-1H-indole-3-carbaldehyde
• 7-Benzyloxyindole-3-carbaldehyde

7-Benzyloxyindole-3-carbaldehyde

CAS: 92855-65-7

Formula: C₁₆H₁₃NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 251.2799

Ref: IN-DA003NDC

7-Benzyloxyindole-3-carboxaldehyde 98%

CAS: 92855-65-7

7-Benzyloxyindole-3-carboxaldehyde 98%

Purity: 98%

Ref: 54-OR1680

7-(Benzyloxy)-1H-indole-3-carbaldehyde

CAS: 92855-65-7

7-(Benzyloxy)-1H-indole-3-carbaldehyde

Purity: 98%

Molecular weight: 251.28g/mol

Ref: 54-OR96492

7-Benzyloxy-3-formylindole

CAS: 92855-65-7

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 251.28500366210938

Ref: 10-F040946

7-Benzyloxindole-3-carboxaldehyde

CAS: 92855-65-7

7-Benzyloxindole-3-carboxaldehyde (BXA) is an assembled molecule that can be synthesized in a scalable and catalytic manner. BXA is an unwanted product that arises from the reaction of 7-benzyloxyindole with adrenaline. The hydrogenolysis of BXA yields the enantiomeric 7-benzyloxyindole, which has been shown to possess anti-inflammatory properties. When debenzylated by hydrogenolysis, crystallization of the byproduct is observed.

Formula: C₁₆H₁₃NO₂

Purity: Min. 95%

Molecular weight: 251.28 g/mol

Ref: 3D-FB10587