CymitQuimica logo

CAS 92855-65-7

:

7-Benzyloxyindole-3-carboxaldehyde

Description:
7-Benzyloxyindole-3-carboxaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a benzyloxy group at the 7-position and an aldehyde functional group at the 3-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a white to off-white solid and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). Its molecular structure allows for various chemical modifications, making it a valuable intermediate in the synthesis of more complex molecules. The aldehyde group can participate in condensation reactions, while the indole moiety is known for its biological activity, including potential roles in neurotransmission and as a scaffold for drug development. As with many organic compounds, proper handling and storage are essential to maintain its stability and prevent degradation.
Formula:C16H13NO2
InChI:InChI=1/C16H13NO2/c18-10-13-9-17-16-14(13)7-4-8-15(16)19-11-12-5-2-1-3-6-12/h1-10,17H,11H2
InChI key:RNARWQXZOKWYHY-UHFFFAOYSA-N
SMILES:c1ccc(cc1)COc1cccc2c(c[nH]c12)C=O
Synonyms:
  • 1H-Indole-3-carboxaldehyde, 7-(phenylmethoxy)-
  • 7-(Benzyloxy)-1H-indole-3-carbaldehyde
  • 7-Benzyloxyindole-3-carbaldehyde
Found 5 products.