CymitQuimica logo

CAS 92858-63-4

:

(2E)-3-(1,3-benzodioxol-5-yl)-1-(4-nitrophenyl)prop-2-en-1-one

Description:
The chemical substance known as (2E)-3-(1,3-benzodioxol-5-yl)-1-(4-nitrophenyl)prop-2-en-1-one, with the CAS number 92858-63-4, is a synthetic organic compound characterized by its conjugated double bond system, which contributes to its potential as a chromophore. This compound features a benzodioxole moiety, which is known for its aromatic properties and ability to participate in various chemical reactions, as well as a nitrophenyl group that can influence its electronic properties and reactivity. The presence of these functional groups suggests that the compound may exhibit interesting biological activities, including potential antioxidant or anti-inflammatory effects. Additionally, its structural configuration indicates that it may be capable of undergoing various chemical transformations, making it a candidate for further research in medicinal chemistry and material science. The compound's solubility, stability, and reactivity would depend on the specific conditions, such as solvent and temperature, under which it is studied.
Formula:C16H11NO5
InChI:InChI=1/C16H11NO5/c18-14(12-3-5-13(6-4-12)17(19)20)7-1-11-2-8-15-16(9-11)22-10-21-15/h1-9H,10H2/b7-1+
Found 1 products.