CymitQuimica logo

CAS 928659-17-0

:

[1,2,4]Triazolo[5,1-c][1,2,4]triazin-4(6H)-one, 7-(methylthio)-3-nitro-, sodium salt, hydrate (1:1:2)

Description:
[1,2,4]Triazolo[5,1-c][1,2,4]triazin-4(6H)-one, 7-(methylthio)-3-nitro-, sodium salt, hydrate (1:1:2) is a complex organic compound characterized by its unique triazole and triazine ring structures, which contribute to its potential biological activity. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the sodium salt and hydrate forms. The methylthio and nitro substituents enhance its reactivity and may influence its pharmacological properties, making it of interest in medicinal chemistry. The presence of multiple nitrogen atoms in its structure can also impart specific electronic characteristics, potentially affecting its interaction with biological targets. As a sodium salt, it is likely to dissociate in solution, which can impact its bioavailability and mechanism of action. Overall, this compound's structural features suggest it may have applications in various fields, including pharmaceuticals and agrochemicals, although specific biological activities would require further investigation.
Formula:C5H4N6O3S·2H2O·Na
InChI:InChI=1S/C5H4N6O3S.Na.2H2O/c1-15-5-6-4-8-7-2(11(13)14)3(12)10(4)9-5;;;/h1H3,(H,6,8,9);;2*1H2
InChI key:InChIKey=PNOMHWQEVJAFBG-UHFFFAOYSA-N
SMILES:O=C1N2C(NC(SC)=N2)=NN=C1N(=O)=O.[Na].O
Synonyms:
  • [1,2,4]Triazolo[5,1-c][1,2,4]triazin-4(6H)-one, 7-(methylthio)-3-nitro-, sodium salt, hydrate (1:1:2)
  • Triazavirin
Found 7 products.