CymitQuimica logo

CAS 928672-86-0

:

Canagliflozin hemihydrate

Description:
Canagliflozin hemihydrate is a pharmaceutical compound primarily used as an antidiabetic medication for the management of type 2 diabetes mellitus. It belongs to the class of sodium-glucose co-transporter 2 (SGLT2) inhibitors, which function by preventing the reabsorption of glucose in the kidneys, thereby promoting its excretion in urine and lowering blood glucose levels. The hemihydrate form indicates that the compound contains half a molecule of water for each molecule of canagliflozin, which can influence its solubility and stability. Canagliflozin is characterized by its specific molecular structure, which includes a substituted phenyl ring and a glucoside moiety, contributing to its pharmacological activity. The compound is typically administered orally and is known to have additional benefits, such as weight loss and cardiovascular protection. As with any medication, it is essential to consider potential side effects and contraindications, and it should be used under medical supervision.
Formula:C24H25FO5S.1/2H2O
InChI:InChI=1S/C24H25FO5S/c1-13-2-3-15(24-23(29)22(28)21(27)19(12-26)30-24)10-16(13)11-18-8-9-20(31-18)14-4-6-17(25)7-5-14/h2-10,19,21-24,26-29H,11-12H2,1H3/t19-,21-,22+,23-,24+/m1/s1
InChI key:XTNGUQKDFGDXSJ-ZXGKGEBGSA-N
SMILES:CC1=C(C=C(C=C1)[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)CC3=CC=C(S3)C4=CC=C(C=C4)F
Synonyms:
  • D-Glucitol, 1,5-anhydro-1-C-[3-[[5-(4-fluorophenyl)-2-thienyl]methyl]-4-methylphenyl]-, hydrate (2:1), (1S)-
Found 7 products.