CAS 928715-37-1
:1-(2-bromo-6-fluoro-phenyl)ethanone
Description:
1-(2-Bromo-6-fluoro-phenyl)ethanone, with the CAS number 928715-37-1, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. The presence of a bromine atom and a fluorine atom on the phenyl ring contributes to its unique reactivity and physical properties. Typically, compounds of this nature exhibit moderate to high polarity due to the electronegative halogen substituents, which can influence their solubility in various solvents. The compound may also display interesting biological activity, making it of interest in medicinal chemistry and drug development. Its structure suggests potential applications in synthesis and as an intermediate in the production of more complex molecules. Additionally, the presence of halogens can enhance the compound's stability and reactivity in electrophilic aromatic substitution reactions. Overall, 1-(2-bromo-6-fluoro-phenyl)ethanone is a valuable compound in organic synthesis and pharmaceutical research, with properties that warrant further investigation.
Formula:C8H6BrFO
InChI:InChI=1/C8H6BrFO/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3
SMILES:CC(=O)c1c(cccc1F)Br
Synonyms:- 1-(2-Bromo-6-fluorophenyl)ethanone
- Ethanone, 1-(2-Bromo-6-Fluorophenyl)-
- 2'-Bromo-6'-fluoroacetophenone 98%
- 2'-BroMo-6'-fluoroacetophenone, 96%
- 1-(2-bromo-6-fluorophenyl)ethan-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2'-Bromo-6'-fluoroacetophenone, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H6BrFOPurity:96%Molecular weight:217.041-(2-Bromo-6-fluorophenyl)ethanone
CAS:Formula:C8H6BrFOPurity:97%Color and Shape:LiquidMolecular weight:217.0350Ref: IN-DA0036RC
1g31.00€5g81.00€10g125.00€1kgTo inquire25g209.00€100gTo inquire250gTo inquire500gTo inquire100mg25.00€250mg25.00€500mg28.00€2'-Bromo-6'-fluoroacetophenone
CAS:2'-Bromo-6'-fluoroacetophenoneFormula:C8H6BrFOPurity:98%Color and Shape: colourless to light yellow liquidMolecular weight:217.04g/mol1-(2-Bromo-6-fluorophenyl)ethanone
CAS:Formula:C8H6BrFOPurity:98%Color and Shape:LiquidMolecular weight:217.037



