CymitQuimica logo

CAS 928715-37-1

:

1-(2-bromo-6-fluoro-phenyl)ethanone

Description:
1-(2-Bromo-6-fluoro-phenyl)ethanone, with the CAS number 928715-37-1, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. The presence of a bromine atom and a fluorine atom on the phenyl ring contributes to its unique reactivity and physical properties. Typically, compounds of this nature exhibit moderate to high polarity due to the electronegative halogen substituents, which can influence their solubility in various solvents. The compound may also display interesting biological activity, making it of interest in medicinal chemistry and drug development. Its structure suggests potential applications in synthesis and as an intermediate in the production of more complex molecules. Additionally, the presence of halogens can enhance the compound's stability and reactivity in electrophilic aromatic substitution reactions. Overall, 1-(2-bromo-6-fluoro-phenyl)ethanone is a valuable compound in organic synthesis and pharmaceutical research, with properties that warrant further investigation.
Formula:C8H6BrFO
InChI:InChI=1/C8H6BrFO/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3
InChI key:ZTLLHQUYOLPVAR-UHFFFAOYSA-N
SMILES:CC(=O)c1c(cccc1F)Br
Synonyms:
  • 1-(2-Bromo-6-fluorophenyl)ethanone
  • Ethanone, 1-(2-Bromo-6-Fluorophenyl)-
  • 2'-Bromo-6'-fluoroacetophenone 98%
  • 2'-BroMo-6'-fluoroacetophenone, 96%
  • 1-(2-bromo-6-fluorophenyl)ethan-1-one
Found 6 products.