CymitQuimica logo

CAS 928754-14-7

:

tert-butyl 3,8-diazabicyclo[4.2.0]octane-3-carboxylate

Description:
Tert-butyl 3,8-diazabicyclo[4.2.0]octane-3-carboxylate is a chemical compound characterized by its bicyclic structure, which includes a diazabicyclo framework. This compound features a tert-butyl ester group, contributing to its solubility and stability. The presence of the diazabicyclo structure indicates potential applications in organic synthesis and medicinal chemistry, particularly due to its ability to act as a ligand or catalyst in various reactions. The carboxylate functional group enhances its reactivity, making it suitable for further chemical modifications. Additionally, the compound may exhibit interesting biological properties, which could be explored in pharmacological studies. Its molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties such as melting point, boiling point, and solubility in different solvents. Overall, tert-butyl 3,8-diazabicyclo[4.2.0]octane-3-carboxylate is a versatile compound with potential applications in both research and industry.
Formula:C11H20N2O2
InChI:InChI=1/C11H20N2O2/c1-11(2,3)15-10(14)13-5-4-8-6-12-9(8)7-13/h8-9,12H,4-7H2,1-3H3
InChI key:VGJOEEIXDPWTAZ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2CNC2C1
Synonyms:
  • 3-Boc-3,8-Diazabicyclo[4.2.0]Octane
Found 4 products.