CymitQuimica logo

CAS 92885-03-5

:

1-(2-aminoethyl)pyrrolidin-2-one hydrochloride

Description:
1-(2-Aminoethyl)pyrrolidin-2-one hydrochloride, also known as a derivative of pyrrolidinone, is a chemical compound characterized by its structural features, which include a pyrrolidine ring and an aminoethyl side chain. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it useful in various applications. The presence of the amino group contributes to its potential as a building block in pharmaceutical synthesis and as a ligand in coordination chemistry. Its hydrochloride salt form enhances its stability and solubility, which is advantageous for biological studies and drug formulation. The compound may exhibit biological activity, including potential neuroprotective effects, and is of interest in medicinal chemistry. As with many chemical substances, safety data should be reviewed, as it may pose hazards if not handled properly. Overall, 1-(2-aminoethyl)pyrrolidin-2-one hydrochloride is a versatile compound with applications in research and development within the fields of chemistry and pharmacology.
Formula:C6H13ClN2O
InChI:InChI=1/C6H12N2O.ClH/c7-3-5-8-4-1-2-6(8)9;/h1-5,7H2;1H
InChI key:MDISFSCSRZPYDO-UHFFFAOYSA-N
SMILES:C1CC(=O)N(C1)CCN.Cl
Found 2 products.