CymitQuimica logo

CAS 929000-22-6

:

1-Naphthalenecarboxylicacid, 4-bromo-, 1,1-dimethylethyl ester

Description:
1-Naphthalenecarboxylic acid, 4-bromo-, 1,1-dimethylethyl ester, also known by its CAS number 929000-22-6, is an organic compound characterized by its naphthalene backbone, which is a fused bicyclic aromatic hydrocarbon. This compound features a carboxylic acid functional group that is esterified with a tert-butyl group, contributing to its hydrophobic properties. The presence of a bromine atom at the 4-position of the naphthalene ring introduces a halogen substituent, which can influence the compound's reactivity and physical properties, such as boiling and melting points. Typically, esters like this one are less polar than their corresponding acids, which can affect their solubility in various solvents. The compound may exhibit interesting biological activities due to its structural features, making it of potential interest in medicinal chemistry and material science. Its synthesis and applications could be explored in various fields, including organic synthesis and pharmaceuticals, although specific applications would depend on further research and development.
Formula:C15H15BrO2
InChI:InChI=1S/C15H15BrO2/c1-15(2,3)18-14(17)12-8-9-13(16)11-7-5-4-6-10(11)12/h4-9H,1-3H3
InChI key:JCSZXGTXRLOCHN-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)C1=CC=C(C2=CC=CC=C21)Br
Synonyms:
  • t-Butyl 4-bromo-1-naphthalenecarboxylate
  • t-Butyl 4-bromo-1-naphthoate
Found 4 products.