CAS 929000-66-8
:3-Bromo-6-chloro-2-pyridinecarboxylic acid
Description:
3-Bromo-6-chloro-2-pyridinecarboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both bromine and chlorine atoms, as well as a carboxylic acid functional group. The bromine atom is located at the 3-position and the chlorine atom at the 6-position of the pyridine ring, which contributes to its unique reactivity and potential applications in various chemical syntheses. The carboxylic acid group enhances its solubility in polar solvents and can participate in acid-base reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various functionalization possibilities, which can be explored for developing new derivatives with specific properties. Additionally, the presence of halogen substituents can influence the compound's electronic properties and reactivity, making it a valuable intermediate in organic synthesis. As with many halogenated compounds, safety precautions should be taken during handling due to potential toxicity and environmental impact.
Formula:C6H3BrClNO2
InChI:InChI=1/C6H3BrClNO2/c7-3-1-2-4(8)9-5(3)6(10)11/h1-2H,(H,10,11)
SMILES:c1cc(Cl)nc(c1Br)C(=O)O
Synonyms:- 3-Bromo-6-chloropicolinic acid
- 3-Bromo-6-Chloro-Pyridine-2-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Bromo-6-chloropyridine-2-carboxylic acid
CAS:Formula:C6H3BrClNO2Purity:97%Color and Shape:SolidMolecular weight:236.45053-Bromo-6-chloro-2-pyridinecarboxylic acid
CAS:3-Bromo-6-chloro-2-pyridinecarboxylic acidFormula:C6H3BrClNO2Purity:≥98%Molecular weight:236.453-Bromo-6-chloro-2-pyridinecarboxylic acid
CAS:3-Bromo-6-chloro-2-pyridinecarboxylic acid is a biochemical reagent that can be used to synthesize other compounds.Formula:C6H3BrClNO2Purity:99.51%Color and Shape:White SolidMolecular weight:236.453-Bromo-6-chloropyridine-2-carboxylic acid
CAS:3-Bromo-6-chloropyridine-2-carboxylic acidFormula:C6H3BrClNO2Purity:97%Color and Shape:White SolidMolecular weight:236.450523-Bromo-6-chloro-2-pyridinecarboxylic acid
CAS:3-Bromo-6-chloropyridine-2-carboxylic acidFormula:C6H3BrClNO2Purity:97%Molecular weight:236.453-Bromo-6-chloropyridine-2-carboxylic acid
CAS:Formula:C6H3BrClNO2Purity:95%Color and Shape:SolidMolecular weight:236.45Ref: 10-F078244
Discontinued product




