CymitQuimica logo

CAS 929000-66-8

:

3-Bromo-6-chloro-2-pyridinecarboxylic acid

Description:
3-Bromo-6-chloro-2-pyridinecarboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both bromine and chlorine atoms, as well as a carboxylic acid functional group. The bromine atom is located at the 3-position and the chlorine atom at the 6-position of the pyridine ring, which contributes to its unique reactivity and potential applications in various chemical syntheses. The carboxylic acid group enhances its solubility in polar solvents and can participate in acid-base reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various functionalization possibilities, which can be explored for developing new derivatives with specific properties. Additionally, the presence of halogen substituents can influence the compound's electronic properties and reactivity, making it a valuable intermediate in organic synthesis. As with many halogenated compounds, safety precautions should be taken during handling due to potential toxicity and environmental impact.
Formula:C6H3BrClNO2
InChI:InChI=1/C6H3BrClNO2/c7-3-1-2-4(8)9-5(3)6(10)11/h1-2H,(H,10,11)
InChI key:RDZPMWLHALUNCD-UHFFFAOYSA-N
SMILES:c1cc(Cl)nc(c1Br)C(=O)O
Synonyms:
  • 3-Bromo-6-chloropicolinic acid
  • 3-Bromo-6-Chloro-Pyridine-2-Carboxylic Acid
Found 6 products.