CymitQuimica logo

CAS 92902-95-9

:

[1-(3-methoxyphenyl)cyclobutyl]methanamine

Description:
[1-(3-methoxyphenyl)cyclobutyl]methanamine, with the CAS number 92902-95-9, is a chemical compound characterized by its unique structure that includes a cyclobutyl group and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The methoxy group can influence its solubility and reactivity, often enhancing lipophilicity, which may affect its biological activity. The cyclobutyl ring contributes to the rigidity of the molecule, potentially impacting its conformational flexibility and interaction with biological targets. Such compounds may be of interest in medicinal chemistry for their potential pharmacological properties, including effects on neurotransmitter systems. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise values. Overall, the compound's unique structural features suggest potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C12H17NO
InChI:InChI=1/C12H17NO/c1-14-11-5-2-4-10(8-11)12(9-13)6-3-7-12/h2,4-5,8H,3,6-7,9,13H2,1H3
InChI key:WNUFPFSPWRRXFM-UHFFFAOYSA-N
SMILES:COc1cccc(c1)C1(CCC1)CN
Synonyms:
  • 1-[1-(3-Methoxyphenyl)cyclobutyl]methanamine
  • Cyclobutanemethanamine, 1-(3-Methoxyphenyl)-
Found 3 products.