CymitQuimica logo

CAS 929022-76-4

:

2-chloro-4-fluoro-pyridine-3-carboxylic acid

Description:
2-Chloro-4-fluoro-pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by a pyridine ring substituted with both a chlorine and a fluorine atom, as well as a carboxylic acid functional group. The presence of these substituents influences its chemical properties, making it a polar molecule with potential for hydrogen bonding due to the carboxylic acid group. This compound is typically used in pharmaceutical and agrochemical research due to its ability to act as a building block for more complex molecules. Its unique electronic properties, derived from the electronegative halogen atoms, can enhance its reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's solubility in polar solvents is influenced by the carboxylic acid group, which can also participate in acid-base reactions. Overall, 2-chloro-4-fluoro-pyridine-3-carboxylic acid is a valuable compound in synthetic organic chemistry, particularly in the development of biologically active molecules.
Formula:C6H3ClFNO2
InChI:InChI=1/C6H3ClFNO2/c7-5-4(6(10)11)3(8)1-2-9-5/h1-2H,(H,10,11)
InChI key:GXDFQGOVWALHAS-UHFFFAOYSA-N
SMILES:c1cnc(c(c1F)C(=O)O)Cl
Synonyms:
  • 3-Pyridinecarboxylic Acid, 2-Chloro-4-Fluoro-
  • 2-Chloro-4-fluoronicotinic acid
Found 4 products.