CymitQuimica logo

CAS 929194-41-2

:

boronic acid, B-(2-fluoro-5-methyl-4-pyridinyl)-

Description:
Boronic acid, specifically B-(2-fluoro-5-methyl-4-pyridinyl)-, is an organoboron compound characterized by the presence of a boronic acid functional group (-B(OH)2) attached to a pyridine ring that is substituted with a fluorine atom and a methyl group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the boronic acid group, which can engage in hydrogen bonding. The fluorine substitution on the pyridine ring can influence its electronic properties, potentially enhancing its reactivity in various chemical reactions, including Suzuki coupling reactions, which are widely used in organic synthesis. Additionally, boronic acids are known for their ability to form reversible complexes with diols, making them useful in the development of sensors and drug delivery systems. The specific structural features of this compound may also impart unique biological activities, making it of interest in medicinal chemistry. Overall, B-(2-fluoro-5-methyl-4-pyridinyl)- boronic acid represents a versatile building block in both synthetic and medicinal chemistry.
Formula:C6H7BFNO2
InChI:InChI=1/C6H7BFNO2/c1-4-3-9-6(8)2-5(4)7(10)11/h2-3,10-11H,1H3
InChI key:ZYZNYWQUVYCGOP-UHFFFAOYSA-N
SMILES:Cc1cnc(cc1B(O)O)F
Synonyms:
  • (2-Fluoro-5-methylpyridin-4-yl)boronic acid
Found 5 products.