CAS 929248-72-6

Formula: C30H46O4

InChI: InChI=1S/C30H46O4/c1-18(9-8-10-19(2)26(33)34)20-11-16-30(7)25-21(12-15-29(20,30)6)28(5)14-13-24(32)27(3,4)23(28)17-22(25)31/h10,18,20,23-24,32H,8-9,11-17H2,1-7H3,(H,33,34)/b19-10+

InChI key: ZNDCXCGTAALLTP-VXLYETTFSA-N

SMILES: CC(CC/C=C(\C)/C(=O)O)C1CCC2(C1(CCC3=C2C(=O)CC4C3(CCC(C4(C)C)O)C)C)C

7-Oxo-ganoderic acid Z

CAS: 929248-72-6

7-Oxo-ganoderic acid Z

Molecular weight: 470.34

Ref: 10-F561910

7-Oxoganoderic acid Z

CAS: 929248-72-6

Formula: C₃₀H₄₆O₄

Purity: 95%~99%

Molecular weight: 470.694

Ref: BP-BP2290

7-Oxoganoderic acid Z

CAS: 929248-72-6

7-Oxoganoderic acid Z is a useful organic compound for research related to life sciences. The catalog number is T123920 and the CAS number is 929248-72-6.

Formula: C₃₀H₄₆O₄

Color and Shape: Solid

Molecular weight: 470.694

Ref: TM-T123920

7-Oxo-ganoderic acid Z

CAS: 929248-72-6

7-Oxo-ganoderic acid Z is a bioactive compound derived from the mushroom Ganoderma lucidum, commonly known as reishi. This triterpenoid is notable for its diverse pharmacological activities, making it a subject of interest in scientific research. Extracted from the fruiting bodies or mycelia of Ganoderma lucidum, it exhibits a range of biochemical actions, primarily modulating inflammatory pathways and exhibiting antioxidant properties.

Formula: C₃₀H₄₆O₄

Purity: Min. 95%

Molecular weight: 470.70 g/mol

Ref: 3D-EMB24872