CymitQuimica logo

CAS 929288-22-2

:

3-Pyridinecarboxylic acid, 4-amino-2,6-dichloro-

Description:
3-Pyridinecarboxylic acid, 4-amino-2,6-dichloro- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group (-COOH) at the 3-position, an amino group (-NH2) at the 4-position, and two chlorine atoms at the 2 and 6 positions of the pyridine ring. The presence of these functional groups contributes to its potential as a biologically active molecule, possibly influencing its solubility, reactivity, and interaction with biological systems. The dichloro substitution can enhance its chemical stability and alter its electronic properties. This compound may be of interest in pharmaceutical research and development due to its structural features, which could lead to various applications in medicinal chemistry. Additionally, its CAS number, 929288-22-2, allows for easy identification and retrieval of information regarding its properties, synthesis, and potential uses in scientific literature and databases.
Formula:C6H4Cl2N2O2
InChI:InChI=1S/C6H4Cl2N2O2/c7-3-1-2(9)4(6(11)12)5(8)10-3/h1H,(H2,9,10)(H,11,12)
InChI key:VOVZKEQDQUXIDG-UHFFFAOYSA-N
SMILES:C1=C(C(=C(N=C1Cl)Cl)C(=O)O)N
Found 5 products.