CAS 92952-46-0
:1H-Benz[g]indole-2,3-dione,6,7,8,9-tetrahydro-
Description:
1H-Benz[g]indole-2,3-dione,6,7,8,9-tetrahydro- is a chemical compound characterized by its complex bicyclic structure, which includes an indole moiety fused with a diketone functionality. This compound features a tetrahydro configuration, indicating the presence of four hydrogenated carbon atoms within its ring system. The presence of the diketone functional groups suggests potential reactivity, particularly in nucleophilic addition or condensation reactions. The compound is likely to exhibit properties typical of indole derivatives, such as biological activity, which may include antimicrobial or anticancer effects, although specific biological data may vary. Its CAS number, 92952-46-0, allows for precise identification in chemical databases. The compound's solubility, stability, and reactivity can be influenced by its molecular structure and functional groups, making it of interest in both synthetic organic chemistry and medicinal chemistry research. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C12H11NO2
InChI:InChI=1S/C12H11NO2/c14-11-9-6-5-7-3-1-2-4-8(7)10(9)13-12(11)15/h5-6H,1-4H2,(H,13,14,15)
InChI key:ADQOEXMBQYZXQN-UHFFFAOYSA-N
SMILES:C1CCC2=C(C1)C=CC3=C2NC(=O)C3=O
Synonyms:- 6,7,8,9-Tetrahydro-1H-benzo[g]indole-2,3-dione
- 6,7,8,9-Tetrahydrobenz[g]isatin
- 6,78,9 Tetrahydrobez(G) Isatin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
