CAS 929637-35-4

Formula: C22H31NO5

InChI: InChI=1S/C22H31NO5/c1-4-12-13-6-5-7-17-23-15(16-8-10(2)20(24)26-16)9-14(22(13,23)28-17)18-11(3)21(25)27-19(12)18/h10-19H,4-9H2,1-3H3/t10-,11+,12+,13+,14+,15-,16-,17-,18+,19-,22-/m0/s1

InChI key: RRHMLMRBONYJOT-SVRYCYPKSA-N

SMILES: CC[C@@H]1[C@H]2CCC[C@H]3N4[C@@]2(O3)[C@H](C[C@H]4[C@@H]5C[C@@H](C(=O)O5)C)[C@@H]6[C@H]1OC(=O)[C@@H]6C

Sessilifoline A

CAS: 929637-35-4

Sessilifoline A is a natural product from Stemona japonica.

Formula: C₂₂H₃₁NO₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 389.4852

Ref: TM-TN5003

Sessilifoline A

CAS: 929637-35-4

Formula: C₂₂H₃₁NO₅

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 389.492

Ref: BP-SBP01176

Sessilifoline A

CAS: 929637-35-4

Sessilifoline A is a natural alkaloid compound, which is derived from specific plant sources notable for their bioactive properties. As a naturally occurring chemical entity, Sessilifoline A is extracted from plants within the Menispermaceae family. This compound exhibits a mode of action primarily based on its interaction with various biological targets, influencing cellular pathways and exhibiting potential anti-inflammatory and cytotoxic effects.

Formula: C₂₂H₃₁NO₅

Purity: Min. 95%

Molecular weight: 389.5 g/mol

Ref: 3D-EMB63735

Sessilifoline A

CAS: 929637-35-4

Formula: C₂₂H₃₁NO₅

Purity: 97.5%

Molecular weight: 389.4852

Ref: IN-DA00H0HU