CymitQuimica logo

CAS 929693-30-1

:

Tert-butyl [(1R,2R,5S)-5-(dimethylcarbamoyl)-2-hydroxycyclohexyl] carbamate

Description:
Tert-butyl [(1R,2R,5S)-5-(dimethylcarbamoyl)-2-hydroxycyclohexyl] carbamate, identified by its CAS number 929693-30-1, is a chemical compound characterized by its carbamate functional group, which is known for its role in various biological and pharmaceutical applications. This compound features a tert-butyl group, contributing to its hydrophobic properties, and a cyclohexyl structure that provides a cyclic framework, enhancing its steric properties. The presence of a dimethylcarbamoyl group indicates potential for interactions with biological systems, as carbamates can participate in hydrogen bonding and other interactions. The specific stereochemistry denoted by (1R,2R,5S) suggests that the compound has defined spatial arrangements, which can significantly influence its biological activity and reactivity. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its stability, solubility, and reactivity would depend on the surrounding conditions and the presence of other functional groups in the molecule.
Formula:C14H26N2O4
InChI:InChI=1S/C14H26N2O4/c1-14(2,3)20-13(19)15-10-8-9(6-7-11(10)17)12(18)16(4)5/h9-11,17H,6-8H2,1-5H3,(H,15,19)/t9-,10+,11+/m0/s1
InChI key:LSKOADYNXKBDTP-HBNTYKKESA-N
SMILES:CC(C)(C)OC(=O)N[C@@H]1C[C@H](CC[C@H]1O)C(=O)N(C)C
Synonyms:
  • 2-Methyl-2-propanyl [(1R,2R,5S)-5-(dimethylcarbamoyl)-2-hydroxycyclohexyl]carbamate
Found 5 products.