CAS 92973-24-5

5-[2-(trifluoromethyl)phenyl]furan-2-carboxylic acid

Description:

5-[2-(Trifluoromethyl)phenyl]furan-2-carboxylic acid is an organic compound characterized by its furan and aromatic ring structure, which contributes to its unique chemical properties. The presence of the trifluoromethyl group (-CF3) enhances its lipophilicity and can influence its reactivity and biological activity. This compound typically exhibits acidic properties due to the carboxylic acid functional group (-COOH), allowing it to participate in various chemical reactions, such as esterification or amidation. The trifluoromethyl group can also impart significant electronic effects, making the compound potentially useful in medicinal chemistry and material science. Additionally, the compound's structure suggests it may have applications in agrochemicals or pharmaceuticals, particularly in the development of compounds with specific biological activities. Its solubility and stability in different solvents can vary, which is important for its practical applications. Overall, 5-[2-(trifluoromethyl)phenyl]furan-2-carboxylic acid is a versatile compound with distinct characteristics that make it of interest in various fields of research.

Formula: C₁₂H₇F₃O₃

InChI: InChI=1/C12H7F3O3/c13-12(14,15)8-4-2-1-3-7(8)9-5-6-10(18-9)11(16)17/h1-6H,(H,16,17)

InChI key: IJPNRBZMRINMMR-UHFFFAOYSA-N

SMILES: c1ccc(c(c1)c1ccc(C(=O)O)o1)C(F)(F)F

Synonyms:

• 2-Furancarboxylic Acid, 5-[2-(Trifluoromethyl)Phenyl]-
• 5-[2-(Trifluoromethyl)phenyl]-2-furoic acid

5-(2-(Trifluoromethyl)Phenyl)Furan-2-Carboxylic Acid

CAS: 92973-24-5

5-(2-(Trifluoromethyl)Phenyl)Furan-2-Carboxylic Acid

Formula: C₁₂H₇F₃O₃

Purity: 98%

Molecular weight: 256.18

Ref: 54-PC109173

5-(2-(Trifluoromethyl)Phenyl)Furan-2-Carboxylic Acid

CAS: 92973-24-5

Formula: C₁₂H₇F₃O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 256.1774

Ref: IN-DA00GYDN

5-[2-(Trifluoromethyl)phenyl]-2-furoic Acid

Controlled Product

CAS: 92973-24-5

Applications 5-[2-(Trifluoromethyl)phenyl]-2-furoic Acid is a chemical reagent used in the preparation of novel TRPV1 antagonists. Also used in the preparation of potent inhibitors of FeII and MnII E, coli Methionine Aminopeptidase as antibacterial agents.
References Huguet, F. et al.: ChemMedChem. 7, 1020 (2012); Kim, N. et al.: Chem. Asian J., 8, 400 (2013);

Formula: C₁₂H₇F₃O₃

Color and Shape: Neat

Molecular weight: 256.18

Ref: TR-T791805