CAS 92973-40-5

methyl 3,4-O-isopropylidene-L-threonate

Description:

Methyl 3,4-O-isopropylidene-L-threonate is an organic compound characterized by its ester functional group and specific stereochemistry associated with the threonate moiety. It features a methyl ester group, which contributes to its solubility in organic solvents and potential reactivity in various chemical reactions. The isopropylidene group provides steric hindrance, influencing the compound's reactivity and stability. This compound is typically used in organic synthesis, particularly in the preparation of more complex molecules, due to its ability to undergo various transformations, such as hydrolysis or transesterification. Its structure allows for potential applications in pharmaceuticals and biochemistry, where chirality and functional group manipulation are crucial. Additionally, the presence of the threonate structure may impart specific biological activities, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.

Formula: C₈H₁₄O₅

InChI: InChI=1/C8H14O5/c1-8(2)12-4-5(13-8)6(9)7(10)11-3/h5-6,9H,4H2,1-3H3/t5-,6+/m0/s1

InChI key: JSFASCPVVJBLRD-NTSWFWBYSA-N

SMILES: CC1(OC[C@H](O1)[C@H](C(=O)OC)O)C

Synonyms:

• methyl (2R)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl](hydroxy)ethanoate

Methyl 3,4-O-isopropylidene-L-threonate

CAS: 92973-40-5

Methyl 3,4-O-isopropylidene-L-threonate

Formula: C₈H₁₄O₅

Purity: 97%

Molecular weight: 190.19

Ref: 54-OR1143498

Methyl 3,4-O-isopropylidene-L-threonate

CAS: 92973-40-5

Methyl 3,4-O-isopropylidene-L-threonate is a type of biochemical reagent used in the study of glycobiology, which explores the structure, synthesis, biology, and evolution of sugars. This field involves carbohydrate chemistry, glycan formation and degradation enzymology, protein-glycan recognition, and the role of glycans in biological systems. It is closely linked to fundamental research, biomedicine, and biotechnology.

Formula: C₈H₁₄O₅

Molecular weight: 190.19

Ref: TM-TSW-00469

Methyl 3,4-O-isopropylidene-L-threonate

CAS: 92973-40-5

Formula: C₈H₁₄O₅

Purity: 98%

Color and Shape: Liquid

Molecular weight: 190.1938

Ref: IN-DA00GS8N

Methyl 3,4-O-isopropylidene-L-threonate

CAS: 92973-40-5

Methyl 3,4-O-isopropylidene-L-threonate is a chromatographic chiral compound that is synthesized by the reaction of malonate and aspartyl amide. This product can be used to determine the stereochemistry of other chiral compounds. It is an endocannabinoid that has been found to have anti-inflammatory activities in animals. Methyl 3,4-O-isopropylidene-L-threonate has also been shown to have antiobesity effects in mice fed a high fat diet and may be used as a synthetic carbohydrate replacement for diabetics.

Formula: C₈H₁₄O₅

Purity: Min. 95%

Molecular weight: 190.19 g/mol

Ref: 3D-MM63237