CymitQuimica logo

CAS 92976-98-2

:

(S)-1,2,3,4-Tetrahydro-Quinoline-2-Carboxylic Acid

Description:
(S)-1,2,3,4-Tetrahydro-Quinoline-2-Carboxylic Acid, with the CAS number 92976-98-2, is a bicyclic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. The stereochemistry indicated by the "(S)" designation suggests that it has a specific three-dimensional arrangement, which can influence its biological activity and interactions. Typically, compounds like this may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The presence of the tetrahydro moiety indicates that the compound is saturated, which can affect its reactivity and stability compared to unsaturated analogs. Additionally, the compound's solubility, melting point, and other physical properties would depend on its molecular interactions and the presence of functional groups. Overall, (S)-1,2,3,4-Tetrahydro-Quinoline-2-Carboxylic Acid is a significant compound in the study of organic chemistry and potential therapeutic applications.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9/h1-4,9,11H,5-6H2,(H,12,13)/t9-/m0/s1
InChI key:OSJVTYVKQNOXPP-VIFPVBQESA-N
SMILES:C1CC2=CC=CC=C2N[C@@H]1C(=O)O
Synonyms:
  • L-1,2,3,4-Tetrahydro-Quinoline-2-Carboxylic Acid
  • 2-Quinolinecarboxylicacid,1,2,3,4-tetrahydro-,(S)-
Found 1 products.