CymitQuimica logo

CAS 929971-93-7

:

N-Boc-8-hydroxy-5-azaspiro[3.5]nonane

Description:
N-Boc-8-hydroxy-5-azaspiro[3.5]nonane is a chemical compound characterized by its unique spirocyclic structure, which includes a bicyclic framework featuring a nitrogen atom within the ring system. The "N-Boc" designation indicates the presence of a tert-butyloxycarbonyl (Boc) protecting group on the nitrogen atom, which is commonly used in organic synthesis to protect amines during chemical reactions. The compound also contains a hydroxyl (-OH) group at the 8-position, contributing to its potential reactivity and solubility in polar solvents. This compound is of interest in medicinal chemistry and drug development due to its structural features that may influence biological activity. Its spirocyclic nature can impart unique conformational properties, potentially affecting interactions with biological targets. Additionally, the presence of both the Boc group and the hydroxyl group suggests that it may serve as a versatile intermediate in the synthesis of more complex molecules. Overall, N-Boc-8-hydroxy-5-azaspiro[3.5]nonane exemplifies the intricate design often found in pharmaceutical chemistry.
Formula:C13H23NO3
InChI:InChI=1S/C13H23NO3/c1-12(2,3)17-11(16)14-8-5-10(15)9-13(14)6-4-7-13/h10,15H,4-9H2,1-3H3
InChI key:HEGAYMHXIDYCSW-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC12CCC2)O
Synonyms:
  • 8-Hydroxy-5-azaspiro[3.5]nonane-5-carboxylic acid 1,1-Dimethylethyl ester
  • 8-Hydroxy-5-aza-spiro3.5none-5-carboxylic acid tert-butyl ester
  • N-Boc-8-hydroxy-5-azaspiro[3.5]nonane
  • 8-Hydroxy-5-aza-spiro[3.5]nonane-5-carboxylic acid tert-butyl ester
Found 4 products.