CymitQuimica logo

CAS 929972-67-8

:

1-(Difluoromethyl)-N-methyl-1H-imidazole-2-methanamine

Description:
1-(Difluoromethyl)-N-methyl-1H-imidazole-2-methanamine, with the CAS number 929972-67-8, is a chemical compound characterized by its unique structure that includes an imidazole ring, a difluoromethyl group, and a methylamine moiety. This compound typically exhibits properties associated with both heterocyclic and amine functionalities, which may influence its reactivity and interaction with biological systems. The presence of the difluoromethyl group can enhance lipophilicity and potentially alter the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. Additionally, the imidazole ring is known for its role in various biological processes and can participate in hydrogen bonding, which may affect its solubility and stability. The compound's specific applications and behavior in chemical reactions would depend on its functional groups and overall molecular architecture, making it a candidate for further research in fields such as drug development or agrochemicals. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C6H9F2N3
InChI:InChI=1S/C6H9F2N3/c1-9-4-5-10-2-3-11(5)6(7)8/h2-3,6,9H,4H2,1H3
InChI key:InChIKey=PCACBZDNEUJGCO-UHFFFAOYSA-N
SMILES:C(F)(F)N1C(CNC)=NC=C1
Synonyms:
  • 1H-Imidazole-2-methanamine, 1-(difluoromethyl)-N-methyl-
  • 1-(Difluoromethyl)-N-methyl-1H-imidazole-2-methanamine
  • {[1-(difluoromethyl)-1H-imidazol-2-yl]methyl}(methyl)amine
  • 1-(1-(Difluoromethyl)-1h-imidazol-2-yl)-n-methylmethanamine
Found 1 products.