CymitQuimica logo

CAS 929973-52-4

:

2-Chloro-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide

Description:
2-Chloro-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide is a chemical compound characterized by its unique molecular structure, which includes a chloro group, an acetamide functional group, and a difluoromethoxy-substituted phenyl ring. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the chloro and acetamide groups. The difluoromethoxy group can influence its electronic properties and lipophilicity, potentially affecting its biological activity. Compounds of this nature are often studied for their pharmacological properties, as they may serve as intermediates in drug development or as active pharmaceutical ingredients. The presence of fluorine atoms can enhance metabolic stability and bioavailability. As with many organic compounds, safety and handling precautions are essential, particularly due to the potential toxicity associated with halogenated compounds. Overall, 2-Chloro-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide represents a complex structure with potential applications in medicinal chemistry.
Formula:C11H12ClF2NO2
InChI:InChI=1S/C11H12ClF2NO2/c12-7-10(16)15-6-5-8-1-3-9(4-2-8)17-11(13)14/h1-4,11H,5-7H2,(H,15,16)
InChI key:InChIKey=BNWHWEFDRPJOTG-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=CC=C(CCNC(CCl)=O)C=C1
Synonyms:
  • 2-Chloro-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide
  • Acetamide, 2-chloro-N-[2-[4-(difluoromethoxy)phenyl]ethyl]-
Found 1 products.