CymitQuimica logo

CAS 929974-07-2

:

2-(1-Methyl-1H-benzimidazol-2-yl)-1-phenylethanone oxime

Description:
2-(1-Methyl-1H-benzimidazol-2-yl)-1-phenylethanone oxime, with the CAS number 929974-07-2, is an organic compound characterized by its unique structural features. It contains a benzimidazole moiety, which contributes to its potential biological activity, and an oxime functional group, indicative of its reactivity and ability to form coordination complexes. The presence of the phenyl group enhances its aromatic character, potentially influencing its solubility and interaction with other molecules. This compound may exhibit properties such as antioxidant activity, making it of interest in various fields, including pharmaceuticals and materials science. Its synthesis typically involves the reaction of appropriate precursors under controlled conditions, and its stability can be influenced by environmental factors such as pH and temperature. As with many organic compounds, understanding its characteristics, including solubility, melting point, and reactivity, is crucial for its application in research and industry. Further studies may be required to fully elucidate its properties and potential uses.
Formula:C16H15N3O
InChI:InChI=1S/C16H15N3O/c1-19-15-10-6-5-9-13(15)17-16(19)11-14(18-20)12-7-3-2-4-8-12/h2-10,20H,11H2,1H3
InChI key:InChIKey=VCGVKTADLHNERP-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1CC(=NO)C3=CC=CC=C3)=CC=CC2
Synonyms:
  • 2-(1-Methyl-1H-benzimidazol-2-yl)-1-phenylethanone oxime
  • Ethanone, 2-(1-methyl-1H-benzimidazol-2-yl)-1-phenyl-, oxime
Found 1 products.