CymitQuimica logo

CAS 929975-61-1

:

1H-Pyrazolo[3,4-b]pyridin-6-ol, 4-methyl-1-(1-methylpropyl)-, 6-(4-methylbenzenesulfonate)

Description:
1H-Pyrazolo[3,4-b]pyridin-6-ol, 4-methyl-1-(1-methylpropyl)-, 6-(4-methylbenzenesulfonate) is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyridine core and a sulfonate group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its nitrogen-containing ring structure. The presence of the sulfonate group enhances its solubility in polar solvents, making it suitable for various applications in medicinal chemistry and drug development. The methyl and isopropyl substituents contribute to its lipophilicity, which can influence its pharmacokinetic properties. Additionally, the compound may exhibit specific reactivity patterns due to the functional groups present, allowing for potential interactions with biological targets. As with many heterocycles, it may also display interesting optical properties and could be investigated for its role in various chemical reactions or as a potential therapeutic agent. Overall, this compound represents a unique combination of structural features that may confer distinct chemical and biological properties.
Formula:C18H21N3O3S
InChI:InChI=1S/C18H21N3O3S/c1-5-14(4)21-18-16(11-19-21)13(3)10-17(20-18)24-25(22,23)15-8-6-12(2)7-9-15/h6-11,14H,5H2,1-4H3
InChI key:InChIKey=PZGGQGYIHLCJOO-UHFFFAOYSA-N
SMILES:C(CC)(C)N1C=2C(=C(C)C=C(OS(=O)(=O)C3=CC=C(C)C=C3)N2)C=N1
Synonyms:
  • 1H-Pyrazolo[3,4-b]pyridin-6-ol, 4-methyl-1-(1-methylpropyl)-, 6-(4-methylbenzenesulfonate)
Found 1 products.