CymitQuimica logo

CAS 93-06-1

:

2-(chloromethyl)-1-methoxy-4-nitrobenzene

Description:
2-(Chloromethyl)-1-methoxy-4-nitrobenzene, with the CAS number 93-06-1, is an organic compound characterized by its aromatic structure, which includes a nitro group and a methoxy group attached to a benzene ring. The presence of the chloromethyl group indicates that it has a reactive site, making it useful in various chemical reactions, particularly in nucleophilic substitution processes. This compound typically appears as a yellow to brown solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. Its nitro group contributes to its electron-withdrawing properties, influencing its reactivity and stability. The methoxy group, being an electron-donating substituent, can affect the compound's overall electronic characteristics. Due to its functional groups, 2-(chloromethyl)-1-methoxy-4-nitrobenzene can be utilized in the synthesis of other chemical compounds, including pharmaceuticals and agrochemicals. However, handling this compound requires caution due to its potential toxicity and reactivity.
Formula:C8H8ClNO3
InChI:InChI=1/C8H8ClNO3/c1-13-8-3-2-7(10(11)12)4-6(8)5-9/h2-4H,5H2,1H3
SMILES:COc1ccc(cc1CCl)N(=O)=O
Found 1 products.