CymitQuimica logo

CAS 930-38-1

:

1-Methyl-1-phospha-3-cyclopentene-1-oxide

Description:
1-Methyl-1-phospha-3-cyclopentene-1-oxide, with the CAS number 930-38-1, is a chemical compound that features a unique structure characterized by a cyclopentene ring with a phosphine oxide functional group. This compound is notable for its phosphorus-containing moiety, which imparts specific reactivity and properties typical of organophosphorus compounds. It is generally a colorless to pale yellow liquid and may exhibit moderate volatility. The presence of the phosphine oxide group contributes to its potential as a ligand in coordination chemistry and its utility in various synthetic applications. Additionally, the compound may display interesting biological activities, making it a subject of interest in medicinal chemistry. Its reactivity can be influenced by the presence of the methyl group, which can affect steric and electronic properties. As with many organophosphorus compounds, safety precautions should be taken when handling this substance due to potential toxicity and environmental concerns.
Formula:C5H9OP
InChI:InChI=1S/C5H9OP/c1-7(6)4-2-3-5-7/h2-3H,4-5H2,1H3
InChI key:InChIKey=MQLQAXIVFGHSDE-UHFFFAOYSA-N
SMILES:CP1(=O)CC=CC1
Synonyms:
  • 1-Methyl-1-oxo-3-phospholene
  • 1-Oxo-1-methyl-3-phospholene
  • 1H-Phosphole, 2,5-dihydro-1-methyl-, 1-oxide
  • 1-Methyl-3-phospholene 1-oxide
  • 3-Phospholene, 1-methyl-, 1-oxide
Found 2 products.